C22H24N2O2S — CID 18961751
ethyl 2-[5-[2-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate (PubChem CID 18961751) has the molecular formula C22H24N2O2S and a molecular weight of 380.51 g/mol. Its IUPAC name is ethyl 2-[5-[2-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate.
| Compound Name | ethyl 2-[5-[2-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
|---|---|
| PubChem CID | 18961751 |
| Molecular Formula | C22H24N2O2S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | ethyl 2-[5-[2-(4,4,7-trimethyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrimidin-2-yl]acetate |
| SMILES | CCOC(=O)Cc1ncc(C#Cc2cc3c(cc2C)SCCC3(C)C)cn1 |
| InChI | InChI=1S/C22H24N2O2S/c1-5-26-21(25)12-20-23-13-16(14-24-20)6-7-17-11-18-19(10-15(17)2)27-9-8-22(18,3)4/h10-11,13-14H,5,8-9,12H2,1-4H3 |
| InChIKey | GDJXODFRNVPNFZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|