About 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione
3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione (PubChem CID 18961907) has the molecular formula C10H13N4O2+
and a molecular weight of 221.24 g/mol. Its IUPAC name is 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione.
Molecular Properties
| Compound Name | 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione |
| PubChem CID | 18961907 |
| Molecular Formula | C10H13N4O2+ |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione |
| SMILES | C=CC[N+]1(C)C=Nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C10H12N4O2/c1-4-5-14(3)6-11-8-7(14)9(15)12-10(16)13(8)2/h4,6H,1,5H2,2-3H3/p+1 |
| InChIKey | RYEWILQXNSWKJB-UHFFFAOYSA-O |
| XLogP | -0.13 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione?
The IUPAC name of 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione (CID 18961907) is 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione.
What is the SMILES notation for 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione?
The canonical SMILES for 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione is C=CC[N+]1(C)C=Nc2c1c(=O)[nH]c(=O)n2C.
What is the InChIKey of 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione?
The InChIKey is RYEWILQXNSWKJB-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H12N4O2/c1-4-5-14(3)6-11-8-7(14)9(15)12-10(16)13(8)2/h4,6H,1,5H2,2-3H3/p+1.
What are the key properties of 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione?
3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione has a molecular weight of 221.24 g/mol, XLogP of -0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-7-prop-2-enylpurin-7-ium-2,6-dione is sourced from PubChem (CID 18961907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).