C22H22BrN5S — CID 18961922
2-bromo-2-[4-[(2-ethylsulfanyl-7-methylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-1-methyl-3H-pyrrole-4-carbonitrile (PubChem CID 18961922) has the molecular formula C22H22BrN5S and a molecular weight of 468.42 g/mol. Its IUPAC name is 2-bromo-2-[4-[(2-ethylsulfanyl-7-methylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-1-methyl-3H-pyrrole-4-carbonitrile.
| Compound Name | 2-bromo-2-[4-[(2-ethylsulfanyl-7-methylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-1-methyl-3H-pyrrole-4-carbonitrile |
|---|---|
| PubChem CID | 18961922 |
| Molecular Formula | C22H22BrN5S |
| Molecular Weight | 468.42 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | 2-bromo-2-[4-[(2-ethylsulfanyl-7-methylimidazo[4,5-b]pyridin-3-yl)methyl]phenyl]-1-methyl-3H-pyrrole-4-carbonitrile |
| SMILES | CCSc1nc2c(C)ccnc2n1Cc1ccc(C2(Br)CC(C#N)=CN2C)cc1 |
| InChI | InChI=1S/C22H22BrN5S/c1-4-29-21-26-19-15(2)9-10-25-20(19)28(21)14-16-5-7-18(8-6-16)22(23)11-17(12-24)13-27(22)3/h5-10,13H,4,11,14H2,1-3H3 |
| InChIKey | YKAZNCWJQHCKIU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 57.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|