C11H16N2 — CID 18962
N'-(2,3-dimethylphenyl)-N,N-dimethylmethanimidamide (PubChem CID 18962) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is N'-(2,3-dimethylphenyl)-N,N-dimethylmethanimidamide.
| Compound Name | N'-(2,3-dimethylphenyl)-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 18962 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | N'-(2,3-dimethylphenyl)-N,N-dimethylmethanimidamide |
| SMILES | Cc1cccc(/N=C/N(C)C)c1C |
| InChI | InChI=1S/C11H16N2/c1-9-6-5-7-11(10(9)2)12-8-13(3)4/h5-8H,1-4H3/b12-8+ |
| InChIKey | UQMISVOZXBSXBQ-XYOKQWHBSA-N |
| XLogP | 2.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|