About 8-sulfanyloctyl octanoate
8-sulfanyloctyl octanoate (PubChem CID 18962131) has the molecular formula C16H32O2S
and a molecular weight of 288.50 g/mol. Its IUPAC name is 8-sulfanyloctyl octanoate.
Molecular Properties
| Compound Name | 8-sulfanyloctyl octanoate |
| PubChem CID | 18962131 |
| Molecular Formula | C16H32O2S |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 8-sulfanyloctyl octanoate |
| SMILES | CCCCCCCC(=O)OCCCCCCCCS |
| InChI | InChI=1S/C16H32O2S/c1-2-3-4-7-10-13-16(17)18-14-11-8-5-6-9-12-15-19/h19H,2-15H2,1H3 |
| InChIKey | PGNAPHLYXZVRSC-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 8-sulfanyloctyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-sulfanyloctyl octanoate?
The IUPAC name of 8-sulfanyloctyl octanoate (CID 18962131) is 8-sulfanyloctyl octanoate.
What is the SMILES notation for 8-sulfanyloctyl octanoate?
The canonical SMILES for 8-sulfanyloctyl octanoate is CCCCCCCC(=O)OCCCCCCCCS.
What is the InChIKey of 8-sulfanyloctyl octanoate?
The InChIKey is PGNAPHLYXZVRSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2S/c1-2-3-4-7-10-13-16(17)18-14-11-8-5-6-9-12-15-19/h19H,2-15H2,1H3.
What are the key properties of 8-sulfanyloctyl octanoate?
8-sulfanyloctyl octanoate has a molecular weight of 288.50 g/mol, XLogP of 5.16, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-sulfanyloctyl octanoate is sourced from PubChem (CID 18962131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).