C15H12Cl2N2O3 — CID 18962720
methyl 4-[(3-amino-2,5-dichlorophenyl)carbamoyl]benzoate (PubChem CID 18962720) has the molecular formula C15H12Cl2N2O3 and a molecular weight of 339.18 g/mol. Its IUPAC name is methyl 4-[(3-amino-2,5-dichlorophenyl)carbamoyl]benzoate.
| Compound Name | methyl 4-[(3-amino-2,5-dichlorophenyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 18962720 |
| Molecular Formula | C15H12Cl2N2O3 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | methyl 4-[(3-amino-2,5-dichlorophenyl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2cc(Cl)cc(N)c2Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2N2O3/c1-22-15(21)9-4-2-8(3-5-9)14(20)19-12-7-10(16)6-11(18)13(12)17/h2-7H,18H2,1H3,(H,19,20) |
| InChIKey | SAPDBENFVXYZKJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|