About 1-sulfonylpropane
1-sulfonylpropane (PubChem CID 18962861) has the molecular formula C3H6O2S
and a molecular weight of 106.15 g/mol. Its IUPAC name is 1-sulfonylpropane.
Molecular Properties
| Compound Name | 1-sulfonylpropane |
| PubChem CID | 18962861 |
| Molecular Formula | C3H6O2S |
| Molecular Weight | 106.15 g/mol |
| Exact Mass | 106.01 |
| IUPAC Name | 1-sulfonylpropane |
| SMILES | CCC=S(=O)=O |
| InChI | InChI=1S/C3H6O2S/c1-2-3-6(4)5/h3H,2H2,1H3 |
| InChIKey | YPOYIZHONBLRQE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.15 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfonylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfonylpropane?
The IUPAC name of 1-sulfonylpropane (CID 18962861) is 1-sulfonylpropane.
What is the SMILES notation for 1-sulfonylpropane?
The canonical SMILES for 1-sulfonylpropane is CCC=S(=O)=O.
What is the InChIKey of 1-sulfonylpropane?
The InChIKey is YPOYIZHONBLRQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S/c1-2-3-6(4)5/h3H,2H2,1H3.
What are the key properties of 1-sulfonylpropane?
1-sulfonylpropane has a molecular weight of 106.15 g/mol, XLogP of 0.08, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfonylpropane is sourced from PubChem (CID 18962861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).