About butane-1,1,2,4-tetrathiol
butane-1,1,2,4-tetrathiol (PubChem CID 18963173) has the molecular formula C4H10S4
and a molecular weight of 186.39 g/mol. Its IUPAC name is butane-1,1,2,4-tetrathiol.
Molecular Properties
| Compound Name | butane-1,1,2,4-tetrathiol |
| PubChem CID | 18963173 |
| Molecular Formula | C4H10S4 |
| Molecular Weight | 186.39 g/mol |
| Exact Mass | 185.97 |
| IUPAC Name | butane-1,1,2,4-tetrathiol |
| SMILES | SCCC(S)C(S)S |
| InChI | InChI=1S/C4H10S4/c5-2-1-3(6)4(7)8/h3-8H,1-2H2 |
| InChIKey | PNGRTBNFGLIPLP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze butane-1,1,2,4-tetrathiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,1,2,4-tetrathiol?
The IUPAC name of butane-1,1,2,4-tetrathiol (CID 18963173) is butane-1,1,2,4-tetrathiol.
What is the SMILES notation for butane-1,1,2,4-tetrathiol?
The canonical SMILES for butane-1,1,2,4-tetrathiol is SCCC(S)C(S)S.
What is the InChIKey of butane-1,1,2,4-tetrathiol?
The InChIKey is PNGRTBNFGLIPLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10S4/c5-2-1-3(6)4(7)8/h3-8H,1-2H2.
What are the key properties of butane-1,1,2,4-tetrathiol?
butane-1,1,2,4-tetrathiol has a molecular weight of 186.39 g/mol, XLogP of 1.79, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,1,2,4-tetrathiol is sourced from PubChem (CID 18963173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).