C15H16N2 — CID 18963254
4,6,7,7a,12,12a-hexahydroindolo[2,3-a]quinolizine (PubChem CID 18963254) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 4,6,7,7a,12,12a-hexahydroindolo[2,3-a]quinolizine.
| Compound Name | 4,6,7,7a,12,12a-hexahydroindolo[2,3-a]quinolizine |
|---|---|
| PubChem CID | 18963254 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4,6,7,7a,12,12a-hexahydroindolo[2,3-a]quinolizine |
| SMILES | C1=CCN2CCC3c4ccccc4NC3C2=C1 |
| InChI | InChI=1S/C15H16N2/c1-2-6-13-11(5-1)12-8-10-17-9-4-3-7-14(17)15(12)16-13/h1-7,12,15-16H,8-10H2 |
| InChIKey | HHPMEEHMTVIODN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |