About benzene-1,2-diol;N-methylmethanamine
benzene-1,2-diol;N-methylmethanamine (PubChem CID 18963537) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is benzene-1,2-diol;N-methylmethanamine.
Molecular Properties
| Compound Name | benzene-1,2-diol;N-methylmethanamine |
| PubChem CID | 18963537 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | benzene-1,2-diol;N-methylmethanamine |
| SMILES | CNC.Oc1ccccc1O |
| InChI | InChI=1S/C6H6O2.C2H7N/c7-5-3-1-2-4-6(5)8;1-3-2/h1-4,7-8H;3H,1-2H3 |
| InChIKey | CVIBPZMYBKBNBO-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze benzene-1,2-diol;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,2-diol;N-methylmethanamine?
The IUPAC name of benzene-1,2-diol;N-methylmethanamine (CID 18963537) is benzene-1,2-diol;N-methylmethanamine.
What is the SMILES notation for benzene-1,2-diol;N-methylmethanamine?
The canonical SMILES for benzene-1,2-diol;N-methylmethanamine is CNC.Oc1ccccc1O.
What is the InChIKey of benzene-1,2-diol;N-methylmethanamine?
The InChIKey is CVIBPZMYBKBNBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O2.C2H7N/c7-5-3-1-2-4-6(5)8;1-3-2/h1-4,7-8H;3H,1-2H3.
What are the key properties of benzene-1,2-diol;N-methylmethanamine?
benzene-1,2-diol;N-methylmethanamine has a molecular weight of 155.20 g/mol, XLogP of 0.93, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,2-diol;N-methylmethanamine is sourced from PubChem (CID 18963537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).