About N-nitramidonitramide
N-nitramidonitramide (PubChem CID 18963690) has the molecular formula H2N4O4
and a molecular weight of 122.04 g/mol. Its IUPAC name is N-nitramidonitramide.
Molecular Properties
| Compound Name | N-nitramidonitramide |
| PubChem CID | 18963690 |
| Molecular Formula | H2N4O4 |
| Molecular Weight | 122.04 g/mol |
| Exact Mass | 122.01 |
| IUPAC Name | N-nitramidonitramide |
| SMILES | O=[N+]([O-])NN[N+](=O)[O-] |
| InChI | InChI=1S/H2N4O4/c5-3(6)1-2-4(7)8/h1-2H |
| InChIKey | VISMKECFKYCCSM-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.04 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-nitramidonitramide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-nitramidonitramide?
The IUPAC name of N-nitramidonitramide (CID 18963690) is N-nitramidonitramide.
What is the SMILES notation for N-nitramidonitramide?
The canonical SMILES for N-nitramidonitramide is O=[N+]([O-])NN[N+](=O)[O-].
What is the InChIKey of N-nitramidonitramide?
The InChIKey is VISMKECFKYCCSM-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N4O4/c5-3(6)1-2-4(7)8/h1-2H.
What are the key properties of N-nitramidonitramide?
N-nitramidonitramide has a molecular weight of 122.04 g/mol, XLogP of -1.54, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-nitramidonitramide is sourced from PubChem (CID 18963690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).