About 2-(2-butoxyethoxy)ethyl hydrogen carbonate
2-(2-butoxyethoxy)ethyl hydrogen carbonate (PubChem CID 18964131) has the molecular formula C9H18O5
and a molecular weight of 206.24 g/mol. Its IUPAC name is 2-(2-butoxyethoxy)ethyl hydrogen carbonate.
Molecular Properties
| Compound Name | 2-(2-butoxyethoxy)ethyl hydrogen carbonate |
| PubChem CID | 18964131 |
| Molecular Formula | C9H18O5 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 2-(2-butoxyethoxy)ethyl hydrogen carbonate |
| SMILES | CCCCOCCOCCOC(=O)O |
| InChI | InChI=1S/C9H18O5/c1-2-3-4-12-5-6-13-7-8-14-9(10)11/h2-8H2,1H3,(H,10,11) |
| InChIKey | RGWZOKCZTGZGEN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-butoxyethoxy)ethyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-butoxyethoxy)ethyl hydrogen carbonate?
The IUPAC name of 2-(2-butoxyethoxy)ethyl hydrogen carbonate (CID 18964131) is 2-(2-butoxyethoxy)ethyl hydrogen carbonate.
What is the SMILES notation for 2-(2-butoxyethoxy)ethyl hydrogen carbonate?
The canonical SMILES for 2-(2-butoxyethoxy)ethyl hydrogen carbonate is CCCCOCCOCCOC(=O)O.
What is the InChIKey of 2-(2-butoxyethoxy)ethyl hydrogen carbonate?
The InChIKey is RGWZOKCZTGZGEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O5/c1-2-3-4-12-5-6-13-7-8-14-9(10)11/h2-8H2,1H3,(H,10,11).
What are the key properties of 2-(2-butoxyethoxy)ethyl hydrogen carbonate?
2-(2-butoxyethoxy)ethyl hydrogen carbonate has a molecular weight of 206.24 g/mol, XLogP of 1.51, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-butoxyethoxy)ethyl hydrogen carbonate is sourced from PubChem (CID 18964131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).