About 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one
2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one (PubChem CID 18964252) has the molecular formula C7H10O2S2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one.
Molecular Properties
| Compound Name | 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one |
| PubChem CID | 18964252 |
| Molecular Formula | C7H10O2S2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one |
| SMILES | CC1SSCC2CC1C(=O)O2 |
| InChI | InChI=1S/C7H10O2S2/c1-4-6-2-5(3-10-11-4)9-7(6)8/h4-6H,2-3H2,1H3 |
| InChIKey | GJNCJWKDUFPCPL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one?
The IUPAC name of 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one (CID 18964252) is 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one.
What is the SMILES notation for 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one?
The canonical SMILES for 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one is CC1SSCC2CC1C(=O)O2.
What is the InChIKey of 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one?
The InChIKey is GJNCJWKDUFPCPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2S2/c1-4-6-2-5(3-10-11-4)9-7(6)8/h4-6H,2-3H2,1H3.
What are the key properties of 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one?
2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one has a molecular weight of 190.29 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7-oxa-3,4-dithiabicyclo[4.2.1]nonan-8-one is sourced from PubChem (CID 18964252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).