About 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one
8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one (PubChem CID 18964255) has the molecular formula C7H10O2S2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one.
Molecular Properties
| Compound Name | 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one |
| PubChem CID | 18964255 |
| Molecular Formula | C7H10O2S2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.01 |
| IUPAC Name | 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one |
| SMILES | O=C1OC2CCSSCC1C2 |
| InChI | InChI=1S/C7H10O2S2/c8-7-5-3-6(9-7)1-2-10-11-4-5/h5-6H,1-4H2 |
| InChIKey | OWLVMSKEAXUBFJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one?
The IUPAC name of 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one (CID 18964255) is 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one.
What is the SMILES notation for 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one?
The canonical SMILES for 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one is O=C1OC2CCSSCC1C2.
What is the InChIKey of 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one?
The InChIKey is OWLVMSKEAXUBFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2S2/c8-7-5-3-6(9-7)1-2-10-11-4-5/h5-6H,1-4H2.
What are the key properties of 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one?
8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one has a molecular weight of 190.29 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-oxa-3,4-dithiabicyclo[5.2.1]decan-9-one is sourced from PubChem (CID 18964255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).