C24H33F13 — CID 18964463
1-butyl-4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)cyclohexyl]cyclohexane (PubChem CID 18964463) has the molecular formula C24H33F13 and a molecular weight of 568.50 g/mol. Its IUPAC name is 1-butyl-4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)cyclohexyl]cyclohexane.
| Compound Name | 1-butyl-4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)cyclohexyl]cyclohexane |
|---|---|
| PubChem CID | 18964463 |
| Molecular Formula | C24H33F13 |
| Molecular Weight | 568.50 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 1-butyl-4-[4-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)cyclohexyl]cyclohexane |
| SMILES | CCCCC1CCC(C2CCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC2)CC1 |
| InChI | InChI=1S/C24H33F13/c1-2-3-4-15-5-9-17(10-6-15)18-11-7-16(8-12-18)13-14-19(25,26)20(27,28)21(29,30)22(31,32)23(33,34)24(35,36)37/h15-18H,2-14H2,1H3 |
| InChIKey | HEUPUHBVZRUVQT-UHFFFAOYSA-N |
| XLogP | 10.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.50 |
| LogP ≤ 5 | 10.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|