C25H28F8N2O2 — CID 18964510
2,2,3,3,4,4,5,5-octafluoropentyl 3-[4-(4-heptylpyrimidin-2-yl)phenyl]propanoate (PubChem CID 18964510) has the molecular formula C25H28F8N2O2 and a molecular weight of 540.50 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5-octafluoropentyl 3-[4-(4-heptylpyrimidin-2-yl)phenyl]propanoate.
| Compound Name | 2,2,3,3,4,4,5,5-octafluoropentyl 3-[4-(4-heptylpyrimidin-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 18964510 |
| Molecular Formula | C25H28F8N2O2 |
| Molecular Weight | 540.50 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 2,2,3,3,4,4,5,5-octafluoropentyl 3-[4-(4-heptylpyrimidin-2-yl)phenyl]propanoate |
| SMILES | CCCCCCCc1ccnc(-c2ccc(CCC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)cc2)n1 |
| InChI | InChI=1S/C25H28F8N2O2/c1-2-3-4-5-6-7-19-14-15-34-21(35-19)18-11-8-17(9-12-18)10-13-20(36)37-16-23(28,29)25(32,33)24(30,31)22(26)27/h8-9,11-12,14-15,22H,2-7,10,13,16H2,1H3 |
| InChIKey | JQTLTHNVPVSDPG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.50 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|