About 2-(1-fluoroethyl)-1,3,5-triazine
2-(1-fluoroethyl)-1,3,5-triazine (PubChem CID 18964718) has the molecular formula C5H6FN3
and a molecular weight of 127.12 g/mol. Its IUPAC name is 2-(1-fluoroethyl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(1-fluoroethyl)-1,3,5-triazine |
| PubChem CID | 18964718 |
| Molecular Formula | C5H6FN3 |
| Molecular Weight | 127.12 g/mol |
| Exact Mass | 127.05 |
| IUPAC Name | 2-(1-fluoroethyl)-1,3,5-triazine |
| SMILES | CC(F)c1ncncn1 |
| InChI | InChI=1S/C5H6FN3/c1-4(6)5-8-2-7-3-9-5/h2-4H,1H3 |
| InChIKey | RCOGTNXXJGZURU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.12 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1-fluoroethyl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-fluoroethyl)-1,3,5-triazine?
The IUPAC name of 2-(1-fluoroethyl)-1,3,5-triazine (CID 18964718) is 2-(1-fluoroethyl)-1,3,5-triazine.
What is the SMILES notation for 2-(1-fluoroethyl)-1,3,5-triazine?
The canonical SMILES for 2-(1-fluoroethyl)-1,3,5-triazine is CC(F)c1ncncn1.
What is the InChIKey of 2-(1-fluoroethyl)-1,3,5-triazine?
The InChIKey is RCOGTNXXJGZURU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FN3/c1-4(6)5-8-2-7-3-9-5/h2-4H,1H3.
What are the key properties of 2-(1-fluoroethyl)-1,3,5-triazine?
2-(1-fluoroethyl)-1,3,5-triazine has a molecular weight of 127.12 g/mol, XLogP of 0.90, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-fluoroethyl)-1,3,5-triazine is sourced from PubChem (CID 18964718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).