About N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine
N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine (PubChem CID 18965059) has the molecular formula C9H22N2O2
and a molecular weight of 190.29 g/mol. Its IUPAC name is N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine |
| PubChem CID | 18965059 |
| Molecular Formula | C9H22N2O2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine |
| SMILES | CNCCN(CCOC)CCOC |
| InChI | InChI=1S/C9H22N2O2/c1-10-4-5-11(6-8-12-2)7-9-13-3/h10H,4-9H2,1-3H3 |
| InChIKey | KMOBHOACVFKFOY-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine?
The IUPAC name of N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine (CID 18965059) is N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine.
What is the SMILES notation for N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine?
The canonical SMILES for N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine is CNCCN(CCOC)CCOC.
What is the InChIKey of N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine?
The InChIKey is KMOBHOACVFKFOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O2/c1-10-4-5-11(6-8-12-2)7-9-13-3/h10H,4-9H2,1-3H3.
What are the key properties of N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine?
N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine has a molecular weight of 190.29 g/mol, XLogP of -0.20, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-bis(2-methoxyethyl)-N-methylethane-1,2-diamine is sourced from PubChem (CID 18965059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).