About N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine
N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine (PubChem CID 18965125) has the molecular formula C10H24N2O2
and a molecular weight of 204.31 g/mol. Its IUPAC name is N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine |
| PubChem CID | 18965125 |
| Molecular Formula | C10H24N2O2 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.18 |
| IUPAC Name | N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine |
| SMILES | CCNCCN(CCOC)CCOC |
| InChI | InChI=1S/C10H24N2O2/c1-4-11-5-6-12(7-9-13-2)8-10-14-3/h11H,4-10H2,1-3H3 |
| InChIKey | CMUVLCYDXIMLFL-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine?
The IUPAC name of N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine (CID 18965125) is N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine.
What is the SMILES notation for N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine?
The canonical SMILES for N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine is CCNCCN(CCOC)CCOC.
What is the InChIKey of N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine?
The InChIKey is CMUVLCYDXIMLFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2O2/c1-4-11-5-6-12(7-9-13-2)8-10-14-3/h11H,4-10H2,1-3H3.
What are the key properties of N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine?
N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine has a molecular weight of 204.31 g/mol, XLogP of 0.19, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N',N'-bis(2-methoxyethyl)ethane-1,2-diamine is sourced from PubChem (CID 18965125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).