C32H32N4O2 — CID 18965184
2,5-dimethyl-1-N,1-N,4-N,4-N-tetraphenylpiperazine-1,4-dicarboxamide (PubChem CID 18965184) has the molecular formula C32H32N4O2 and a molecular weight of 504.63 g/mol. Its IUPAC name is 2,5-dimethyl-1-N,1-N,4-N,4-N-tetraphenylpiperazine-1,4-dicarboxamide.
| Compound Name | 2,5-dimethyl-1-N,1-N,4-N,4-N-tetraphenylpiperazine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 18965184 |
| Molecular Formula | C32H32N4O2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | 2,5-dimethyl-1-N,1-N,4-N,4-N-tetraphenylpiperazine-1,4-dicarboxamide |
| SMILES | CC1CN(C(=O)N(c2ccccc2)c2ccccc2)C(C)CN1C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H32N4O2/c1-25-23-34(32(38)36(29-19-11-5-12-20-29)30-21-13-6-14-22-30)26(2)24-33(25)31(37)35(27-15-7-3-8-16-27)28-17-9-4-10-18-28/h3-22,25-26H,23-24H2,1-2H3 |
| InChIKey | IZBDDCUHDIOAAN-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |