About 2,4-dichloro-6-cyclopropyl-1,3,5-triazine
2,4-dichloro-6-cyclopropyl-1,3,5-triazine (PubChem CID 18965220) has the molecular formula C6H5Cl2N3
and a molecular weight of 190.03 g/mol. Its IUPAC name is 2,4-dichloro-6-cyclopropyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-dichloro-6-cyclopropyl-1,3,5-triazine |
| PubChem CID | 18965220 |
| Molecular Formula | C6H5Cl2N3 |
| Molecular Weight | 190.03 g/mol |
| Exact Mass | 188.99 |
| IUPAC Name | 2,4-dichloro-6-cyclopropyl-1,3,5-triazine |
| SMILES | Clc1nc(Cl)nc(C2CC2)n1 |
| InChI | InChI=1S/C6H5Cl2N3/c7-5-9-4(3-1-2-3)10-6(8)11-5/h3H,1-2H2 |
| InChIKey | RHYYBHZFUCSINS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.03 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dichloro-6-cyclopropyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-6-cyclopropyl-1,3,5-triazine?
The IUPAC name of 2,4-dichloro-6-cyclopropyl-1,3,5-triazine (CID 18965220) is 2,4-dichloro-6-cyclopropyl-1,3,5-triazine.
What is the SMILES notation for 2,4-dichloro-6-cyclopropyl-1,3,5-triazine?
The canonical SMILES for 2,4-dichloro-6-cyclopropyl-1,3,5-triazine is Clc1nc(Cl)nc(C2CC2)n1.
What is the InChIKey of 2,4-dichloro-6-cyclopropyl-1,3,5-triazine?
The InChIKey is RHYYBHZFUCSINS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2N3/c7-5-9-4(3-1-2-3)10-6(8)11-5/h3H,1-2H2.
What are the key properties of 2,4-dichloro-6-cyclopropyl-1,3,5-triazine?
2,4-dichloro-6-cyclopropyl-1,3,5-triazine has a molecular weight of 190.03 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-6-cyclopropyl-1,3,5-triazine is sourced from PubChem (CID 18965220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).