C9H18ClN5O2S — CID 18965221
N'-(N'-cyclopropylcarbamimidoyl)-1,1-dioxo-1,4-thiazinane-4-carboximidamide;hydrochloride (PubChem CID 18965221) has the molecular formula C9H18ClN5O2S and a molecular weight of 295.80 g/mol. Its IUPAC name is N'-(N'-cyclopropylcarbamimidoyl)-1,1-dioxo-1,4-thiazinane-4-carboximidamide;hydrochloride.
| Compound Name | N'-(N'-cyclopropylcarbamimidoyl)-1,1-dioxo-1,4-thiazinane-4-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 18965221 |
| Molecular Formula | C9H18ClN5O2S |
| Molecular Weight | 295.80 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | N'-(N'-cyclopropylcarbamimidoyl)-1,1-dioxo-1,4-thiazinane-4-carboximidamide;hydrochloride |
| SMILES | Cl.NC(=N\C1CC1)/N=C(\N)N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H17N5O2S.ClH/c10-8(12-7-1-2-7)13-9(11)14-3-5-17(15,16)6-4-14;/h7H,1-6H2,(H4,10,11,12,13);1H |
| InChIKey | HNTMZWKSPOWIPF-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.80 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|