C14H28NO2S- — CID 18965279
2-[1-(3,4-dimethylpiperidin-1-yl)ethyl]pentane-1-sulfinate (PubChem CID 18965279) has the molecular formula C14H28NO2S- and a molecular weight of 274.45 g/mol. Its IUPAC name is 2-[1-(3,4-dimethylpiperidin-1-yl)ethyl]pentane-1-sulfinate.
| Compound Name | 2-[1-(3,4-dimethylpiperidin-1-yl)ethyl]pentane-1-sulfinate |
|---|---|
| PubChem CID | 18965279 |
| Molecular Formula | C14H28NO2S- |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 2-[1-(3,4-dimethylpiperidin-1-yl)ethyl]pentane-1-sulfinate |
| SMILES | CCCC(CS(=O)[O-])C(C)N1CCC(C)C(C)C1 |
| InChI | InChI=1S/C14H29NO2S/c1-5-6-14(10-18(16)17)13(4)15-8-7-11(2)12(3)9-15/h11-14H,5-10H2,1-4H3,(H,16,17)/p-1 |
| InChIKey | GAPFMURMZUTVJP-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|