About 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol
3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol (PubChem CID 18965787) has the molecular formula C9H8O
and a molecular weight of 132.16 g/mol. Its IUPAC name is 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol.
Molecular Properties
| Compound Name | 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol |
| PubChem CID | 18965787 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol |
| SMILES | OCc1ccc2c(c1)C=C2 |
| InChI | InChI=1S/C9H8O/c10-6-7-1-2-8-3-4-9(8)5-7/h1-5,10H,6H2 |
| InChIKey | CUVVWDAHRRSSII-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol?
The IUPAC name of 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol (CID 18965787) is 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol.
What is the SMILES notation for 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol?
The canonical SMILES for 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol is OCc1ccc2c(c1)C=C2.
What is the InChIKey of 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol?
The InChIKey is CUVVWDAHRRSSII-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O/c10-6-7-1-2-8-3-4-9(8)5-7/h1-5,10H,6H2.
What are the key properties of 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol?
3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol has a molecular weight of 132.16 g/mol, XLogP of 1.66, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bicyclo[4.2.0]octa-1(6),2,4,7-tetraenylmethanol is sourced from PubChem (CID 18965787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).