C17H19I3N2O6 — CID 18965979
6-(3,5-diacetamido-2,4,6-triiodobenzoyl)oxyhexanoic acid (PubChem CID 18965979) has the molecular formula C17H19I3N2O6 and a molecular weight of 728.06 g/mol. Its IUPAC name is 6-(3,5-diacetamido-2,4,6-triiodobenzoyl)oxyhexanoic acid.
| Compound Name | 6-(3,5-diacetamido-2,4,6-triiodobenzoyl)oxyhexanoic acid |
|---|---|
| PubChem CID | 18965979 |
| Molecular Formula | C17H19I3N2O6 |
| Molecular Weight | 728.06 g/mol |
| Exact Mass | 727.84 |
| IUPAC Name | 6-(3,5-diacetamido-2,4,6-triiodobenzoyl)oxyhexanoic acid |
| SMILES | CC(=O)Nc1c(I)c(NC(C)=O)c(I)c(C(=O)OCCCCCC(=O)O)c1I |
| InChI | InChI=1S/C17H19I3N2O6/c1-8(23)21-15-12(18)11(13(19)16(14(15)20)22-9(2)24)17(27)28-7-5-3-4-6-10(25)26/h3-7H2,1-2H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | LJDIBKHDVCEULG-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.06 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|