About 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol
11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol (PubChem CID 18966008) has the molecular formula C17H18O3
and a molecular weight of 270.33 g/mol. Its IUPAC name is 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol.
Molecular Properties
| Compound Name | 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol |
| PubChem CID | 18966008 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol |
| SMILES | CCC1c2ccc(O)cc2OC(C)c2cc(O)ccc21 |
| InChI | InChI=1S/C17H18O3/c1-3-13-14-6-4-11(18)8-16(14)10(2)20-17-9-12(19)5-7-15(13)17/h4-10,13,18-19H,3H2,1-2H3 |
| InChIKey | HLXALDXZRRYKAV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol?
The IUPAC name of 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol (CID 18966008) is 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol.
What is the SMILES notation for 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol?
The canonical SMILES for 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol is CCC1c2ccc(O)cc2OC(C)c2cc(O)ccc21.
What is the InChIKey of 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol?
The InChIKey is HLXALDXZRRYKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O3/c1-3-13-14-6-4-11(18)8-16(14)10(2)20-17-9-12(19)5-7-15(13)17/h4-10,13,18-19H,3H2,1-2H3.
What are the key properties of 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol?
11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol has a molecular weight of 270.33 g/mol, XLogP of 4.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-ethyl-6-methyl-6,11-dihydrobenzo[c][1]benzoxepine-3,8-diol is sourced from PubChem (CID 18966008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).