About 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal
3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal (PubChem CID 18966082) has the molecular formula C17H18Cl2N2O3S
and a molecular weight of 401.32 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal |
| PubChem CID | 18966082 |
| Molecular Formula | C17H18Cl2N2O3S |
| Molecular Weight | 401.32 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal |
| SMILES | COc1cc(OC)nc(SC(C=O)C(C)(C)c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H18Cl2N2O3S/c1-17(2,10-5-6-11(18)12(19)7-10)13(9-22)25-16-20-14(23-3)8-15(21-16)24-4/h5-9,13H,1-4H3 |
| InChIKey | XDDGDZIHXNMSAZ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.32 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal?
The IUPAC name of 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal (CID 18966082) is 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal?
The canonical SMILES for 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal is COc1cc(OC)nc(SC(C=O)C(C)(C)c2ccc(Cl)c(Cl)c2)n1.
What is the InChIKey of 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal?
The InChIKey is XDDGDZIHXNMSAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O3S/c1-17(2,10-5-6-11(18)12(19)7-10)13(9-22)25-16-20-14(23-3)8-15(21-16)24-4/h5-9,13H,1-4H3.
What are the key properties of 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal?
3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal has a molecular weight of 401.32 g/mol, XLogP of 4.44, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-methylbutanal is sourced from PubChem (CID 18966082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).