About 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol
2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol (PubChem CID 18966120) has the molecular formula C13H22N2O3S
and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol.
Molecular Properties
| Compound Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol |
| PubChem CID | 18966120 |
| Molecular Formula | C13H22N2O3S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol |
| SMILES | CCC(CC)C(CO)Sc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C13H22N2O3S/c1-5-9(6-2)10(8-16)19-13-14-11(17-3)7-12(15-13)18-4/h7,9-10,16H,5-6,8H2,1-4H3 |
| InChIKey | UBANDMGZPSTIIN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol?
The IUPAC name of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol (CID 18966120) is 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol.
What is the SMILES notation for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol?
The canonical SMILES for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol is CCC(CC)C(CO)Sc1nc(OC)cc(OC)n1.
What is the InChIKey of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol?
The InChIKey is UBANDMGZPSTIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3S/c1-5-9(6-2)10(8-16)19-13-14-11(17-3)7-12(15-13)18-4/h7,9-10,16H,5-6,8H2,1-4H3.
What are the key properties of 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol?
2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol has a molecular weight of 286.40 g/mol, XLogP of 2.38, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethoxypyrimidin-2-yl)sulfanyl-3-ethylpentan-1-ol is sourced from PubChem (CID 18966120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).