C11H12N2O2 — CID 18966549
5,5-dimethyl-1,3-bis(prop-2-ynyl)imidazolidine-2,4-dione (PubChem CID 18966549) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 5,5-dimethyl-1,3-bis(prop-2-ynyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-dimethyl-1,3-bis(prop-2-ynyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 18966549 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 5,5-dimethyl-1,3-bis(prop-2-ynyl)imidazolidine-2,4-dione |
| SMILES | C#CCN1C(=O)N(CC#C)C(C)(C)C1=O |
| InChI | InChI=1S/C11H12N2O2/c1-5-7-12-9(14)11(3,4)13(8-6-2)10(12)15/h1-2H,7-8H2,3-4H3 |
| InChIKey | SRILTELXUDTWPZ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|