About 7-hydroxy-3H-1,3-benzoxazole-2-thione
7-hydroxy-3H-1,3-benzoxazole-2-thione (PubChem CID 18967016) has the molecular formula C7H5NO2S
and a molecular weight of 167.19 g/mol. Its IUPAC name is 7-hydroxy-3H-1,3-benzoxazole-2-thione.
Molecular Properties
| Compound Name | 7-hydroxy-3H-1,3-benzoxazole-2-thione |
| PubChem CID | 18967016 |
| Molecular Formula | C7H5NO2S |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | 7-hydroxy-3H-1,3-benzoxazole-2-thione |
| SMILES | Oc1cccc2[nH]c(=S)oc12 |
| InChI | InChI=1S/C7H5NO2S/c9-5-3-1-2-4-6(5)10-7(11)8-4/h1-3,9H,(H,8,11) |
| InChIKey | LQTMMYCMJYFBGI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-3H-1,3-benzoxazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-3H-1,3-benzoxazole-2-thione?
The IUPAC name of 7-hydroxy-3H-1,3-benzoxazole-2-thione (CID 18967016) is 7-hydroxy-3H-1,3-benzoxazole-2-thione.
What is the SMILES notation for 7-hydroxy-3H-1,3-benzoxazole-2-thione?
The canonical SMILES for 7-hydroxy-3H-1,3-benzoxazole-2-thione is Oc1cccc2[nH]c(=S)oc12.
What is the InChIKey of 7-hydroxy-3H-1,3-benzoxazole-2-thione?
The InChIKey is LQTMMYCMJYFBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2S/c9-5-3-1-2-4-6(5)10-7(11)8-4/h1-3,9H,(H,8,11).
What are the key properties of 7-hydroxy-3H-1,3-benzoxazole-2-thione?
7-hydroxy-3H-1,3-benzoxazole-2-thione has a molecular weight of 167.19 g/mol, XLogP of 2.20, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-3H-1,3-benzoxazole-2-thione is sourced from PubChem (CID 18967016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).