About 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione
6-methylsulfonyl-3H-1,3-benzothiazole-2-thione (PubChem CID 18967131) has the molecular formula C8H7NO2S3
and a molecular weight of 245.35 g/mol. Its IUPAC name is 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione.
Molecular Properties
| Compound Name | 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione |
| PubChem CID | 18967131 |
| Molecular Formula | C8H7NO2S3 |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 244.96 |
| IUPAC Name | 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione |
| SMILES | CS(=O)(=O)c1ccc2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C8H7NO2S3/c1-14(10,11)5-2-3-6-7(4-5)13-8(12)9-6/h2-4H,1H3,(H,9,12) |
| InChIKey | YBSMSNSADXVROP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione?
The IUPAC name of 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione (CID 18967131) is 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione.
What is the SMILES notation for 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione?
The canonical SMILES for 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione is CS(=O)(=O)c1ccc2[nH]c(=S)sc2c1.
What is the InChIKey of 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione?
The InChIKey is YBSMSNSADXVROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S3/c1-14(10,11)5-2-3-6-7(4-5)13-8(12)9-6/h2-4H,1H3,(H,9,12).
What are the key properties of 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione?
6-methylsulfonyl-3H-1,3-benzothiazole-2-thione has a molecular weight of 245.35 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylsulfonyl-3H-1,3-benzothiazole-2-thione is sourced from PubChem (CID 18967131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).