About 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid
2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid (PubChem CID 18967151) has the molecular formula C16H18N2O5S
and a molecular weight of 350.40 g/mol. Its IUPAC name is 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid.
Molecular Properties
| Compound Name | 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid |
| PubChem CID | 18967151 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid |
| SMILES | O=C(O)CC(Cc1nc2c(N3CCOCC3)cccc2s1)C(=O)O |
| InChI | InChI=1S/C16H18N2O5S/c19-14(20)9-10(16(21)22)8-13-17-15-11(2-1-3-12(15)24-13)18-4-6-23-7-5-18/h1-3,10H,4-9H2,(H,19,20)(H,21,22) |
| InChIKey | XWZMMKUJRWVHRV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid?
The IUPAC name of 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid (CID 18967151) is 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid.
What is the SMILES notation for 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid?
The canonical SMILES for 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid is O=C(O)CC(Cc1nc2c(N3CCOCC3)cccc2s1)C(=O)O.
What is the InChIKey of 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid?
The InChIKey is XWZMMKUJRWVHRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2O5S/c19-14(20)9-10(16(21)22)8-13-17-15-11(2-1-3-12(15)24-13)18-4-6-23-7-5-18/h1-3,10H,4-9H2,(H,19,20)(H,21,22).
What are the key properties of 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid?
2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid has a molecular weight of 350.40 g/mol, XLogP of 1.85, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-morpholin-4-yl-1,3-benzothiazol-2-yl)methyl]butanedioic acid is sourced from PubChem (CID 18967151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).