C16H46O8Si8 — CID 18967227
2-[1-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 18967227) has the molecular formula C16H46O8Si8 and a molecular weight of 591.22 g/mol. Its IUPAC name is 2-[1-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-[1-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 18967227 |
| Molecular Formula | C16H46O8Si8 |
| Molecular Weight | 591.22 g/mol |
| Exact Mass | 590.13 |
| IUPAC Name | 2-[1-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CC([Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1)[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C16H46O8Si8/c1-16(31(14)21-27(6,7)17-25(2,3)18-28(8,9)22-31)32(15)23-29(10,11)19-26(4,5)20-30(12,13)24-32/h16H,1-15H3 |
| InChIKey | GICXPDMORPBXDD-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.22 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|