C19H21N7O — CID 18967384
4-[[4-(3-methylanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]piperidine-1-carbaldehyde (PubChem CID 18967384) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is 4-[[4-(3-methylanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]piperidine-1-carbaldehyde.
| Compound Name | 4-[[4-(3-methylanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 18967384 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | 4-[[4-(3-methylanilino)pyrimido[5,4-d]pyrimidin-6-yl]amino]piperidine-1-carbaldehyde |
| SMILES | Cc1cccc(Nc2ncnc3cnc(NC4CCN(C=O)CC4)nc23)c1 |
| InChI | InChI=1S/C19H21N7O/c1-13-3-2-4-15(9-13)23-18-17-16(21-11-22-18)10-20-19(25-17)24-14-5-7-26(12-27)8-6-14/h2-4,9-12,14H,5-8H2,1H3,(H,20,24,25)(H,21,22,23) |
| InChIKey | LGYZTZZKMZEECR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|