C24H28Cl2N2O2S — CID 18967784
4-(2,4-dichlorophenyl)-N-[2-(1-methoxyethoxy)-1-phenylethyl]-5-methyl-N-propyl-1,3-thiazol-2-amine (PubChem CID 18967784) has the molecular formula C24H28Cl2N2O2S and a molecular weight of 479.47 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[2-(1-methoxyethoxy)-1-phenylethyl]-5-methyl-N-propyl-1,3-thiazol-2-amine.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[2-(1-methoxyethoxy)-1-phenylethyl]-5-methyl-N-propyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 18967784 |
| Molecular Formula | C24H28Cl2N2O2S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[2-(1-methoxyethoxy)-1-phenylethyl]-5-methyl-N-propyl-1,3-thiazol-2-amine |
| SMILES | CCCN(c1nc(-c2ccc(Cl)cc2Cl)c(C)s1)C(COC(C)OC)c1ccccc1 |
| InChI | InChI=1S/C24H28Cl2N2O2S/c1-5-13-28(22(15-30-17(3)29-4)18-9-7-6-8-10-18)24-27-23(16(2)31-24)20-12-11-19(25)14-21(20)26/h6-12,14,17,22H,5,13,15H2,1-4H3 |
| InChIKey | PLHDTJDFNQTHRV-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|