About 1,1-difluorobutane
1,1-difluorobutane (PubChem CID 18967886) has the molecular formula C4H8F2
and a molecular weight of 94.10 g/mol. Its IUPAC name is 1,1-difluorobutane.
Molecular Properties
| Compound Name | 1,1-difluorobutane |
| PubChem CID | 18967886 |
| Molecular Formula | C4H8F2 |
| Molecular Weight | 94.10 g/mol |
| Exact Mass | 94.06 |
| IUPAC Name | 1,1-difluorobutane |
| SMILES | CCCC(F)F |
| InChI | InChI=1S/C4H8F2/c1-2-3-4(5)6/h4H,2-3H2,1H3 |
| InChIKey | CPLSOYONVLSMGL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.10 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1-difluorobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluorobutane?
The IUPAC name of 1,1-difluorobutane (CID 18967886) is 1,1-difluorobutane.
What is the SMILES notation for 1,1-difluorobutane?
The canonical SMILES for 1,1-difluorobutane is CCCC(F)F.
What is the InChIKey of 1,1-difluorobutane?
The InChIKey is CPLSOYONVLSMGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F2/c1-2-3-4(5)6/h4H,2-3H2,1H3.
What are the key properties of 1,1-difluorobutane?
1,1-difluorobutane has a molecular weight of 94.10 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluorobutane is sourced from PubChem (CID 18967886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).