About 1-cyclohexylethanol;1-methylcyclooctan-1-ol
1-cyclohexylethanol;1-methylcyclooctan-1-ol (PubChem CID 18968457) has the molecular formula C17H34O2
and a molecular weight of 270.46 g/mol. Its IUPAC name is 1-cyclohexylethanol;1-methylcyclooctan-1-ol.
Molecular Properties
| Compound Name | 1-cyclohexylethanol;1-methylcyclooctan-1-ol |
| PubChem CID | 18968457 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 1-cyclohexylethanol;1-methylcyclooctan-1-ol |
| SMILES | CC(O)C1CCCCC1.CC1(O)CCCCCCC1 |
| InChI | InChI=1S/C9H18O.C8H16O/c1-9(10)7-5-3-2-4-6-8-9;1-7(9)8-5-3-2-4-6-8/h10H,2-8H2,1H3;7-9H,2-6H2,1H3 |
| InChIKey | ZFBIAFNPWRWNNJ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexylethanol;1-methylcyclooctan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylethanol;1-methylcyclooctan-1-ol?
The IUPAC name of 1-cyclohexylethanol;1-methylcyclooctan-1-ol (CID 18968457) is 1-cyclohexylethanol;1-methylcyclooctan-1-ol.
What is the SMILES notation for 1-cyclohexylethanol;1-methylcyclooctan-1-ol?
The canonical SMILES for 1-cyclohexylethanol;1-methylcyclooctan-1-ol is CC(O)C1CCCCC1.CC1(O)CCCCCCC1.
What is the InChIKey of 1-cyclohexylethanol;1-methylcyclooctan-1-ol?
The InChIKey is ZFBIAFNPWRWNNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O.C8H16O/c1-9(10)7-5-3-2-4-6-8-9;1-7(9)8-5-3-2-4-6-8/h10H,2-8H2,1H3;7-9H,2-6H2,1H3.
What are the key properties of 1-cyclohexylethanol;1-methylcyclooctan-1-ol?
1-cyclohexylethanol;1-methylcyclooctan-1-ol has a molecular weight of 270.46 g/mol, XLogP of 4.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylethanol;1-methylcyclooctan-1-ol is sourced from PubChem (CID 18968457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).