About 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid
2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid (PubChem CID 18969095) has the molecular formula C12H8N4O5S2
and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid.
Molecular Properties
| Compound Name | 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| PubChem CID | 18969095 |
| Molecular Formula | C12H8N4O5S2 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid |
| SMILES | CS(=O)(=O)c1ncc2c(=O)c(C(=O)O)cn(-c3nccs3)c2n1 |
| InChI | InChI=1S/C12H8N4O5S2/c1-23(20,21)11-14-4-6-8(17)7(10(18)19)5-16(9(6)15-11)12-13-2-3-22-12/h2-5H,1H3,(H,18,19) |
| InChIKey | CCDCCLYILFQNEK-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid?
The IUPAC name of 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid (CID 18969095) is 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid.
What is the SMILES notation for 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid?
The canonical SMILES for 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid is CS(=O)(=O)c1ncc2c(=O)c(C(=O)O)cn(-c3nccs3)c2n1.
What is the InChIKey of 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid?
The InChIKey is CCDCCLYILFQNEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O5S2/c1-23(20,21)11-14-4-6-8(17)7(10(18)19)5-16(9(6)15-11)12-13-2-3-22-12/h2-5H,1H3,(H,18,19).
What are the key properties of 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid?
2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid has a molecular weight of 352.35 g/mol, XLogP of 0.34, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonyl-5-oxo-8-(1,3-thiazol-2-yl)pyrido[2,3-d]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 18969095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).