About 4-phenyl-1-propyl-1,8-naphthyridin-2-one
4-phenyl-1-propyl-1,8-naphthyridin-2-one (PubChem CID 18969191) has the molecular formula C17H16N2O
and a molecular weight of 264.33 g/mol. Its IUPAC name is 4-phenyl-1-propyl-1,8-naphthyridin-2-one.
Molecular Properties
| Compound Name | 4-phenyl-1-propyl-1,8-naphthyridin-2-one |
| PubChem CID | 18969191 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-phenyl-1-propyl-1,8-naphthyridin-2-one |
| SMILES | CCCn1c(=O)cc(-c2ccccc2)c2cccnc21 |
| InChI | InChI=1S/C17H16N2O/c1-2-11-19-16(20)12-15(13-7-4-3-5-8-13)14-9-6-10-18-17(14)19/h3-10,12H,2,11H2,1H3 |
| InChIKey | AXXNDJPZTTUTDO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenyl-1-propyl-1,8-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1-propyl-1,8-naphthyridin-2-one?
The IUPAC name of 4-phenyl-1-propyl-1,8-naphthyridin-2-one (CID 18969191) is 4-phenyl-1-propyl-1,8-naphthyridin-2-one.
What is the SMILES notation for 4-phenyl-1-propyl-1,8-naphthyridin-2-one?
The canonical SMILES for 4-phenyl-1-propyl-1,8-naphthyridin-2-one is CCCn1c(=O)cc(-c2ccccc2)c2cccnc21.
What is the InChIKey of 4-phenyl-1-propyl-1,8-naphthyridin-2-one?
The InChIKey is AXXNDJPZTTUTDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O/c1-2-11-19-16(20)12-15(13-7-4-3-5-8-13)14-9-6-10-18-17(14)19/h3-10,12H,2,11H2,1H3.
What are the key properties of 4-phenyl-1-propyl-1,8-naphthyridin-2-one?
4-phenyl-1-propyl-1,8-naphthyridin-2-one has a molecular weight of 264.33 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1-propyl-1,8-naphthyridin-2-one is sourced from PubChem (CID 18969191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).