About bicyclo[7.2.0]undecane
bicyclo[7.2.0]undecane (PubChem CID 18969257) has the molecular formula C11H20
and a molecular weight of 152.28 g/mol. Its IUPAC name is bicyclo[7.2.0]undecane.
Molecular Properties
| Compound Name | bicyclo[7.2.0]undecane |
| PubChem CID | 18969257 |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 g/mol |
| Exact Mass | 152.16 |
| IUPAC Name | bicyclo[7.2.0]undecane |
| SMILES | C1CCCC2CCC2CCC1 |
| InChI | InChI=1S/C11H20/c1-2-4-6-10-8-9-11(10)7-5-3-1/h10-11H,1-9H2 |
| InChIKey | SQXVFJBNABHFQG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bicyclo[7.2.0]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[7.2.0]undecane?
The IUPAC name of bicyclo[7.2.0]undecane (CID 18969257) is bicyclo[7.2.0]undecane.
What is the SMILES notation for bicyclo[7.2.0]undecane?
The canonical SMILES for bicyclo[7.2.0]undecane is C1CCCC2CCC2CCC1.
What is the InChIKey of bicyclo[7.2.0]undecane?
The InChIKey is SQXVFJBNABHFQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20/c1-2-4-6-10-8-9-11(10)7-5-3-1/h10-11H,1-9H2.
What are the key properties of bicyclo[7.2.0]undecane?
bicyclo[7.2.0]undecane has a molecular weight of 152.28 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[7.2.0]undecane is sourced from PubChem (CID 18969257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).