C19H17FO3S — CID 18969710
2-(4-fluorophenyl)-4,4-dimethyl-3-(4-methylsulfonylphenyl)cyclobut-2-en-1-one (PubChem CID 18969710) has the molecular formula C19H17FO3S and a molecular weight of 344.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4,4-dimethyl-3-(4-methylsulfonylphenyl)cyclobut-2-en-1-one.
| Compound Name | 2-(4-fluorophenyl)-4,4-dimethyl-3-(4-methylsulfonylphenyl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 18969710 |
| Molecular Formula | C19H17FO3S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-(4-fluorophenyl)-4,4-dimethyl-3-(4-methylsulfonylphenyl)cyclobut-2-en-1-one |
| SMILES | CC1(C)C(=O)C(c2ccc(F)cc2)=C1c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H17FO3S/c1-19(2)17(13-6-10-15(11-7-13)24(3,22)23)16(18(19)21)12-4-8-14(20)9-5-12/h4-11H,1-3H3 |
| InChIKey | BIKVSCVPZGXPRO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|