About 2,3,4,5-tetramethyl-2H-stibole
2,3,4,5-tetramethyl-2H-stibole (PubChem CID 18969852) has the molecular formula C8H13Sb
and a molecular weight of 230.95 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-2H-stibole.
Molecular Properties
| Compound Name | 2,3,4,5-tetramethyl-2H-stibole |
| PubChem CID | 18969852 |
| Molecular Formula | C8H13Sb |
| Molecular Weight | 230.95 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 2,3,4,5-tetramethyl-2H-stibole |
| SMILES | CC1=[Sb]C(C)C(C)=C1C |
| InChI | InChI=1S/C8H13.Sb/c1-5-7(3)8(4)6-2;/h5H,1-4H3;/b8-7-; |
| InChIKey | MVRHCXRNXSCJRR-CFYXSCKTSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.95 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3,4,5-tetramethyl-2H-stibole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetramethyl-2H-stibole?
The IUPAC name of 2,3,4,5-tetramethyl-2H-stibole (CID 18969852) is 2,3,4,5-tetramethyl-2H-stibole.
What is the SMILES notation for 2,3,4,5-tetramethyl-2H-stibole?
The canonical SMILES for 2,3,4,5-tetramethyl-2H-stibole is CC1=[Sb]C(C)C(C)=C1C.
What is the InChIKey of 2,3,4,5-tetramethyl-2H-stibole?
The InChIKey is MVRHCXRNXSCJRR-CFYXSCKTSA-N. The full InChI is InChI=1S/C8H13.Sb/c1-5-7(3)8(4)6-2;/h5H,1-4H3;/b8-7-;.
What are the key properties of 2,3,4,5-tetramethyl-2H-stibole?
2,3,4,5-tetramethyl-2H-stibole has a molecular weight of 230.95 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetramethyl-2H-stibole is sourced from PubChem (CID 18969852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).