About 2,3,4,5-tetramethyl-2H-bismole
2,3,4,5-tetramethyl-2H-bismole (PubChem CID 18970019) has the molecular formula C8H13Bi
and a molecular weight of 318.17 g/mol. Its IUPAC name is 2,3,4,5-tetramethyl-2H-bismole.
Molecular Properties
| Compound Name | 2,3,4,5-tetramethyl-2H-bismole |
| PubChem CID | 18970019 |
| Molecular Formula | C8H13Bi |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2,3,4,5-tetramethyl-2H-bismole |
| SMILES | CC1=[Bi]C(C)C(C)=C1C |
| InChI | InChI=1S/C8H13.Bi/c1-5-7(3)8(4)6-2;/h5H,1-4H3;/b8-7-; |
| InChIKey | PZULMTSNYFJZMX-CFYXSCKTSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3,4,5-tetramethyl-2H-bismole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,5-tetramethyl-2H-bismole?
The IUPAC name of 2,3,4,5-tetramethyl-2H-bismole (CID 18970019) is 2,3,4,5-tetramethyl-2H-bismole.
What is the SMILES notation for 2,3,4,5-tetramethyl-2H-bismole?
The canonical SMILES for 2,3,4,5-tetramethyl-2H-bismole is CC1=[Bi]C(C)C(C)=C1C.
What is the InChIKey of 2,3,4,5-tetramethyl-2H-bismole?
The InChIKey is PZULMTSNYFJZMX-CFYXSCKTSA-N. The full InChI is InChI=1S/C8H13.Bi/c1-5-7(3)8(4)6-2;/h5H,1-4H3;/b8-7-;.
What are the key properties of 2,3,4,5-tetramethyl-2H-bismole?
2,3,4,5-tetramethyl-2H-bismole has a molecular weight of 318.17 g/mol, XLogP of 2.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,5-tetramethyl-2H-bismole is sourced from PubChem (CID 18970019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).