C18H24O5 — CID 18970180
diethyl 3-phenylmethoxycyclopentane-1,1-dicarboxylate (PubChem CID 18970180) has the molecular formula C18H24O5 and a molecular weight of 320.38 g/mol. Its IUPAC name is diethyl 3-phenylmethoxycyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-phenylmethoxycyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 18970180 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | diethyl 3-phenylmethoxycyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CCC(OCc2ccccc2)C1 |
| InChI | InChI=1S/C18H24O5/c1-3-21-16(19)18(17(20)22-4-2)11-10-15(12-18)23-13-14-8-6-5-7-9-14/h5-9,15H,3-4,10-13H2,1-2H3 |
| InChIKey | DUDIGEJQZDJOPP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|