About N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide
N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide (PubChem CID 18970218) has the molecular formula C11H16N4O3
and a molecular weight of 252.27 g/mol. Its IUPAC name is N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide.
Molecular Properties
| Compound Name | N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide |
| PubChem CID | 18970218 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide |
| SMILES | C=CC(=O)N(CCCCN)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16N4O3/c1-2-9(16)15(6-4-3-5-12)8-7-13-11(18)14-10(8)17/h2,7H,1,3-6,12H2,(H2,13,14,17,18) |
| InChIKey | RJBYASZSLDDCSG-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide?
The IUPAC name of N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide (CID 18970218) is N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide.
What is the SMILES notation for N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide?
The canonical SMILES for N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide is C=CC(=O)N(CCCCN)c1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide?
The InChIKey is RJBYASZSLDDCSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4O3/c1-2-9(16)15(6-4-3-5-12)8-7-13-11(18)14-10(8)17/h2,7H,1,3-6,12H2,(H2,13,14,17,18).
What are the key properties of N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide?
N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide has a molecular weight of 252.27 g/mol, XLogP of -0.68, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminobutyl)-N-(2,4-dioxo-1H-pyrimidin-5-yl)prop-2-enamide is sourced from PubChem (CID 18970218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).