C17H28N2O4 — CID 18970394
ditert-butyl 3,5,7,7a-tetrahydro-2H-pyrrolo[3,4-b]pyridine-1,6-dicarboxylate (PubChem CID 18970394) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is ditert-butyl 3,5,7,7a-tetrahydro-2H-pyrrolo[3,4-b]pyridine-1,6-dicarboxylate.
| Compound Name | ditert-butyl 3,5,7,7a-tetrahydro-2H-pyrrolo[3,4-b]pyridine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 18970394 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | ditert-butyl 3,5,7,7a-tetrahydro-2H-pyrrolo[3,4-b]pyridine-1,6-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2=CCCN(C(=O)OC(C)(C)C)C2C1 |
| InChI | InChI=1S/C17H28N2O4/c1-16(2,3)22-14(20)18-10-12-8-7-9-19(13(12)11-18)15(21)23-17(4,5)6/h8,13H,7,9-11H2,1-6H3 |
| InChIKey | LRMWPGGMAXHOGE-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|