About 5-amino-4,6-dimethylbenzimidazol-2-one
5-amino-4,6-dimethylbenzimidazol-2-one (PubChem CID 18970466) has the molecular formula C9H9N3O
and a molecular weight of 175.19 g/mol. Its IUPAC name is 5-amino-4,6-dimethylbenzimidazol-2-one.
Molecular Properties
| Compound Name | 5-amino-4,6-dimethylbenzimidazol-2-one |
| PubChem CID | 18970466 |
| Molecular Formula | C9H9N3O |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 5-amino-4,6-dimethylbenzimidazol-2-one |
| SMILES | Cc1cc2c(c(C)c1N)=NC(=O)N=2 |
| InChI | InChI=1S/C9H9N3O/c1-4-3-6-8(5(2)7(4)10)12-9(13)11-6/h3H,10H2,1-2H3 |
| InChIKey | UWKZLCDJMQZKKE-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-4,6-dimethylbenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-4,6-dimethylbenzimidazol-2-one?
The IUPAC name of 5-amino-4,6-dimethylbenzimidazol-2-one (CID 18970466) is 5-amino-4,6-dimethylbenzimidazol-2-one.
What is the SMILES notation for 5-amino-4,6-dimethylbenzimidazol-2-one?
The canonical SMILES for 5-amino-4,6-dimethylbenzimidazol-2-one is Cc1cc2c(c(C)c1N)=NC(=O)N=2.
What is the InChIKey of 5-amino-4,6-dimethylbenzimidazol-2-one?
The InChIKey is UWKZLCDJMQZKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O/c1-4-3-6-8(5(2)7(4)10)12-9(13)11-6/h3H,10H2,1-2H3.
What are the key properties of 5-amino-4,6-dimethylbenzimidazol-2-one?
5-amino-4,6-dimethylbenzimidazol-2-one has a molecular weight of 175.19 g/mol, XLogP of 0.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-4,6-dimethylbenzimidazol-2-one is sourced from PubChem (CID 18970466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).