About 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one
4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one (PubChem CID 18970516) has the molecular formula C7H10O3S6
and a molecular weight of 334.56 g/mol. Its IUPAC name is 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one.
Molecular Properties
| Compound Name | 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one |
| PubChem CID | 18970516 |
| Molecular Formula | C7H10O3S6 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 333.90 |
| IUPAC Name | 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one |
| SMILES | CC(O)SSc1sc(=O)sc1SSC(C)O |
| InChI | InChI=1S/C7H10O3S6/c1-3(8)13-15-5-6(12-7(10)11-5)16-14-4(2)9/h3-4,8-9H,1-2H3 |
| InChIKey | IGVAOKCUPYFLMA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one?
The IUPAC name of 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one (CID 18970516) is 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one.
What is the SMILES notation for 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one?
The canonical SMILES for 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one is CC(O)SSc1sc(=O)sc1SSC(C)O.
What is the InChIKey of 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one?
The InChIKey is IGVAOKCUPYFLMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3S6/c1-3(8)13-15-5-6(12-7(10)11-5)16-14-4(2)9/h3-4,8-9H,1-2H3.
What are the key properties of 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one?
4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one has a molecular weight of 334.56 g/mol, XLogP of 3.33, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(1-hydroxyethyldisulfanyl)-1,3-dithiol-2-one is sourced from PubChem (CID 18970516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).