C25H20ClF2NO5 — CID 18970561
2-butoxy-3-(2-chloro-6-methylanilino)-1,4-difluoro-5,8-dihydroxyanthracene-9,10-dione (PubChem CID 18970561) has the molecular formula C25H20ClF2NO5 and a molecular weight of 487.89 g/mol. Its IUPAC name is 2-butoxy-3-(2-chloro-6-methylanilino)-1,4-difluoro-5,8-dihydroxyanthracene-9,10-dione.
| Compound Name | 2-butoxy-3-(2-chloro-6-methylanilino)-1,4-difluoro-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 18970561 |
| Molecular Formula | C25H20ClF2NO5 |
| Molecular Weight | 487.89 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | 2-butoxy-3-(2-chloro-6-methylanilino)-1,4-difluoro-5,8-dihydroxyanthracene-9,10-dione |
| SMILES | CCCCOc1c(F)c2c(c(F)c1Nc1c(C)cccc1Cl)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C25H20ClF2NO5/c1-3-4-10-34-25-20(28)18-17(19(27)22(25)29-21-11(2)6-5-7-12(21)26)23(32)15-13(30)8-9-14(31)16(15)24(18)33/h5-9,29-31H,3-4,10H2,1-2H3 |
| InChIKey | XSIDNEUMMRUQRL-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.89 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|