C38H26N2O3S — CID 18970669
1,4-dianilino-5-hydroxy-2,3-diphenyl-8-sulfanylanthracene-9,10-dione (PubChem CID 18970669) has the molecular formula C38H26N2O3S and a molecular weight of 590.70 g/mol. Its IUPAC name is 1,4-dianilino-5-hydroxy-2,3-diphenyl-8-sulfanylanthracene-9,10-dione.
| Compound Name | 1,4-dianilino-5-hydroxy-2,3-diphenyl-8-sulfanylanthracene-9,10-dione |
|---|---|
| PubChem CID | 18970669 |
| Molecular Formula | C38H26N2O3S |
| Molecular Weight | 590.70 g/mol |
| Exact Mass | 590.17 |
| IUPAC Name | 1,4-dianilino-5-hydroxy-2,3-diphenyl-8-sulfanylanthracene-9,10-dione |
| SMILES | O=C1c2c(O)ccc(S)c2C(=O)c2c(Nc3ccccc3)c(-c3ccccc3)c(-c3ccccc3)c(Nc3ccccc3)c21 |
| InChI | InChI=1S/C38H26N2O3S/c41-27-21-22-28(44)32-31(27)37(42)33-34(38(32)43)36(40-26-19-11-4-12-20-26)30(24-15-7-2-8-16-24)29(23-13-5-1-6-14-23)35(33)39-25-17-9-3-10-18-25/h1-22,39-41,44H |
| InChIKey | HKFVHLZUVMNUSE-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.70 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|